About 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium
2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium (PubChem CID 21289029) has the molecular formula C11H27NO2
and a molecular weight of 205.34 g/mol. Its IUPAC name is 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium.
Molecular Properties
| Compound Name | 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium |
| PubChem CID | 21289029 |
| Molecular Formula | C11H27NO2 |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.20 |
| IUPAC Name | 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium |
| SMILES | CC(C)(C)O[N+](C)(C)C.CC(C)(C)[O-] |
| InChI | InChI=1S/C7H18NO.C4H9O/c1-7(2,3)9-8(4,5)6;1-4(2,3)5/h1-6H3;1-3H3/q+1;-1 |
| InChIKey | AWYUGEMMEXWUEB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium?
The IUPAC name of 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium (CID 21289029) is 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium.
What is the SMILES notation for 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium?
The canonical SMILES for 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium is CC(C)(C)O[N+](C)(C)C.CC(C)(C)[O-].
What is the InChIKey of 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium?
The InChIKey is AWYUGEMMEXWUEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18NO.C4H9O/c1-7(2,3)9-8(4,5)6;1-4(2,3)5/h1-6H3;1-3H3/q+1;-1.
What are the key properties of 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium?
2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium has a molecular weight of 205.34 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-2-olate;trimethyl-[(2-methylpropan-2-yl)oxy]azanium is sourced from PubChem (CID 21289029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).