About 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane
2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane (PubChem CID 21289240) has the molecular formula C24H50O4
and a molecular weight of 402.66 g/mol. Its IUPAC name is 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane.
Molecular Properties
| Compound Name | 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane |
| PubChem CID | 21289240 |
| Molecular Formula | C24H50O4 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.37 |
| IUPAC Name | 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane |
| SMILES | CCCCCC(C)(C)OOC(C)(C)CCC(C)(C)OOC(C)(C)CCCCC |
| InChI | InChI=1S/C24H50O4/c1-11-13-15-17-21(3,4)25-27-23(7,8)19-20-24(9,10)28-26-22(5,6)18-16-14-12-2/h11-20H2,1-10H3 |
| InChIKey | UROIGDJTKKDYRS-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane?
The IUPAC name of 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane (CID 21289240) is 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane.
What is the SMILES notation for 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane?
The canonical SMILES for 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane is CCCCCC(C)(C)OOC(C)(C)CCC(C)(C)OOC(C)(C)CCCCC.
What is the InChIKey of 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane?
The InChIKey is UROIGDJTKKDYRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50O4/c1-11-13-15-17-21(3,4)25-27-23(7,8)19-20-24(9,10)28-26-22(5,6)18-16-14-12-2/h11-20H2,1-10H3.
What are the key properties of 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane?
2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane has a molecular weight of 402.66 g/mol, XLogP of 7.94, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-2,5-bis(2-methylheptan-2-ylperoxy)hexane is sourced from PubChem (CID 21289240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).