C20H31NO4 — CID 21289475
ethyl 5-[(2,2-diethoxyethylamino)methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxylate (PubChem CID 21289475) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is ethyl 5-[(2,2-diethoxyethylamino)methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxylate.
| Compound Name | ethyl 5-[(2,2-diethoxyethylamino)methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 21289475 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | ethyl 5-[(2,2-diethoxyethylamino)methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)CCCC2CNCC(OCC)OCC |
| InChI | InChI=1S/C20H31NO4/c1-4-23-19(24-5-2)14-21-13-17-9-7-8-15-12-16(10-11-18(15)17)20(22)25-6-3/h10-12,17,19,21H,4-9,13-14H2,1-3H3 |
| InChIKey | SYFAQZNXOPHMST-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|