About 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride
4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride (PubChem CID 21289642) has the molecular formula C12H26FNO3
and a molecular weight of 251.34 g/mol. Its IUPAC name is 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride.
Molecular Properties
| Compound Name | 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride |
| PubChem CID | 21289642 |
| Molecular Formula | C12H26FNO3 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride |
| SMILES | CC1COC(=O)O1.CC[N+](CC)(CC)CC.[F-] |
| InChI | InChI=1S/C8H20N.C4H6O3.FH/c1-5-9(6-2,7-3)8-4;1-3-2-6-4(5)7-3;/h5-8H2,1-4H3;3H,2H2,1H3;1H/q+1;;/p-1 |
| InChIKey | NJDPWGOHKKOEAX-UHFFFAOYSA-M |
| XLogP | -0.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride?
The IUPAC name of 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride (CID 21289642) is 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride.
What is the SMILES notation for 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride?
The canonical SMILES for 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride is CC1COC(=O)O1.CC[N+](CC)(CC)CC.[F-].
What is the InChIKey of 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride?
The InChIKey is NJDPWGOHKKOEAX-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.C4H6O3.FH/c1-5-9(6-2,7-3)8-4;1-3-2-6-4(5)7-3;/h5-8H2,1-4H3;3H,2H2,1H3;1H/q+1;;/p-1.
What are the key properties of 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride?
4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride has a molecular weight of 251.34 g/mol, XLogP of -0.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-dioxolan-2-one;tetraethylazanium;fluoride is sourced from PubChem (CID 21289642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).