About [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate
[2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate (PubChem CID 21290131) has the molecular formula C28H38ClN3O2
and a molecular weight of 484.08 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate.
Molecular Properties
| Compound Name | [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate |
| PubChem CID | 21290131 |
| Molecular Formula | C28H38ClN3O2 |
| Molecular Weight | 484.08 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1c(-n2nc3ccc(Cl)cc3n2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C28H38ClN3O2/c1-8-9-10-11-12-13-25(33)34-26-21(28(5,6)7)16-19(27(2,3)4)17-24(26)32-30-22-15-14-20(29)18-23(22)31-32/h14-18H,8-13H2,1-7H3 |
| InChIKey | TZOSXHJNUHRSQD-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.08 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate?
The IUPAC name of [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate (CID 21290131) is [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate.
What is the SMILES notation for [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate?
The canonical SMILES for [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate is CCCCCCCC(=O)Oc1c(-n2nc3ccc(Cl)cc3n2)cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate?
The InChIKey is TZOSXHJNUHRSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H38ClN3O2/c1-8-9-10-11-12-13-25(33)34-26-21(28(5,6)7)16-19(27(2,3)4)17-24(26)32-30-22-15-14-20(29)18-23(22)31-32/h14-18H,8-13H2,1-7H3.
What are the key properties of [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate?
[2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate has a molecular weight of 484.08 g/mol, XLogP of 7.93, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-ditert-butyl-6-(5-chlorobenzotriazol-2-yl)phenyl] octanoate is sourced from PubChem (CID 21290131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).