C12H14N2 — CID 21290200
1-N,4-N-bis(prop-2-enyl)cyclohexa-2,5-diene-1,4-diimine (PubChem CID 21290200) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1-N,4-N-bis(prop-2-enyl)cyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 1-N,4-N-bis(prop-2-enyl)cyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 21290200 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-N,4-N-bis(prop-2-enyl)cyclohexa-2,5-diene-1,4-diimine |
| SMILES | C=CCN=C1C=CC(=NCC=C)C=C1 |
| InChI | InChI=1S/C12H14N2/c1-3-9-13-11-5-7-12(8-6-11)14-10-4-2/h3-8H,1-2,9-10H2/b13-11-,14-12+ |
| InChIKey | OTZGOZSCRYZELN-HEEUSZRZSA-N |
| XLogP | 2.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|