About N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine
N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine (PubChem CID 21290587) has the molecular formula C9H13F2N3
and a molecular weight of 201.22 g/mol. Its IUPAC name is N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine |
| PubChem CID | 21290587 |
| Molecular Formula | C9H13F2N3 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine |
| SMILES | NCCCNCc1cc(F)nc(F)c1 |
| InChI | InChI=1S/C9H13F2N3/c10-8-4-7(5-9(11)14-8)6-13-3-1-2-12/h4-5,13H,1-3,6,12H2 |
| InChIKey | PMZNWPGFMGFDSR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine?
The IUPAC name of N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine (CID 21290587) is N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine.
What is the SMILES notation for N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine?
The canonical SMILES for N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine is NCCCNCc1cc(F)nc(F)c1.
What is the InChIKey of N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine?
The InChIKey is PMZNWPGFMGFDSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3/c10-8-4-7(5-9(11)14-8)6-13-3-1-2-12/h4-5,13H,1-3,6,12H2.
What are the key properties of N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine?
N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine has a molecular weight of 201.22 g/mol, XLogP of 0.80, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2,6-difluoro-4-pyridinyl)methyl]propane-1,3-diamine is sourced from PubChem (CID 21290587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).