About (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane
(2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane (PubChem CID 21290600) has the molecular formula C11H13ClN4O2
and a molecular weight of 268.70 g/mol. Its IUPAC name is (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane.
Molecular Properties
| Compound Name | (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane |
| PubChem CID | 21290600 |
| Molecular Formula | C11H13ClN4O2 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane |
| SMILES | O=[N+]([O-])/C=C1/NCCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H13ClN4O2/c12-10-3-2-9(6-14-10)7-15-5-1-4-13-11(15)8-16(17)18/h2-3,6,8,13H,1,4-5,7H2/b11-8- |
| InChIKey | GEOWRBWWMXCKFQ-FLIBITNWSA-N |
| XLogP | 1.61 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane?
The IUPAC name of (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane (CID 21290600) is (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane.
What is the SMILES notation for (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane?
The canonical SMILES for (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane is O=[N+]([O-])/C=C1/NCCCN1Cc1ccc(Cl)nc1.
What is the InChIKey of (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane?
The InChIKey is GEOWRBWWMXCKFQ-FLIBITNWSA-N. The full InChI is InChI=1S/C11H13ClN4O2/c12-10-3-2-9(6-14-10)7-15-5-1-4-13-11(15)8-16(17)18/h2-3,6,8,13H,1,4-5,7H2/b11-8-.
What are the key properties of (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane?
(2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane has a molecular weight of 268.70 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-1-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethylidene)-1,3-diazinane is sourced from PubChem (CID 21290600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).