About 1,1,2,2-tetrachlorodisiletane
1,1,2,2-tetrachlorodisiletane (PubChem CID 21290819) has the molecular formula C2H4Cl4Si2
and a molecular weight of 226.04 g/mol. Its IUPAC name is 1,1,2,2-tetrachlorodisiletane.
Molecular Properties
| Compound Name | 1,1,2,2-tetrachlorodisiletane |
| PubChem CID | 21290819 |
| Molecular Formula | C2H4Cl4Si2 |
| Molecular Weight | 226.04 g/mol |
| Exact Mass | 223.86 |
| IUPAC Name | 1,1,2,2-tetrachlorodisiletane |
| SMILES | Cl[Si]1(Cl)CC[Si]1(Cl)Cl |
| InChI | InChI=1S/C2H4Cl4Si2/c3-7(4)1-2-8(7,5)6/h1-2H2 |
| InChIKey | DVWIZGHKRFFMNS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.04 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2,2-tetrachlorodisiletane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2,2-tetrachlorodisiletane?
The IUPAC name of 1,1,2,2-tetrachlorodisiletane (CID 21290819) is 1,1,2,2-tetrachlorodisiletane.
What is the SMILES notation for 1,1,2,2-tetrachlorodisiletane?
The canonical SMILES for 1,1,2,2-tetrachlorodisiletane is Cl[Si]1(Cl)CC[Si]1(Cl)Cl.
What is the InChIKey of 1,1,2,2-tetrachlorodisiletane?
The InChIKey is DVWIZGHKRFFMNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4Cl4Si2/c3-7(4)1-2-8(7,5)6/h1-2H2.
What are the key properties of 1,1,2,2-tetrachlorodisiletane?
1,1,2,2-tetrachlorodisiletane has a molecular weight of 226.04 g/mol, XLogP of 2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,2-tetrachlorodisiletane is sourced from PubChem (CID 21290819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).