About (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid
(E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid (PubChem CID 21291072) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid |
| PubChem CID | 21291072 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid |
| SMILES | CCCCCC(=O)OC(C)(C)/C(C)=C/C(=O)O |
| InChI | InChI=1S/C13H22O4/c1-5-6-7-8-12(16)17-13(3,4)10(2)9-11(14)15/h9H,5-8H2,1-4H3,(H,14,15)/b10-9+ |
| InChIKey | JSXAREPMFMDEPF-MDZDMXLPSA-N |
| XLogP | 2.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid?
The IUPAC name of (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid (CID 21291072) is (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid.
What is the SMILES notation for (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid?
The canonical SMILES for (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid is CCCCCC(=O)OC(C)(C)/C(C)=C/C(=O)O.
What is the InChIKey of (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid?
The InChIKey is JSXAREPMFMDEPF-MDZDMXLPSA-N. The full InChI is InChI=1S/C13H22O4/c1-5-6-7-8-12(16)17-13(3,4)10(2)9-11(14)15/h9H,5-8H2,1-4H3,(H,14,15)/b10-9+.
What are the key properties of (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid?
(E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid has a molecular weight of 242.31 g/mol, XLogP of 2.92, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-hexanoyloxy-3,4-dimethylpent-2-enoic acid is sourced from PubChem (CID 21291072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).