About ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene
ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene (PubChem CID 21291280) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene.
Molecular Properties
| Compound Name | ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
| PubChem CID | 21291280 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
| SMILES | CCO.c1cc2ccc1o2 |
| InChI | InChI=1S/C6H4O.C2H6O/c1-2-6-4-3-5(1)7-6;1-2-3/h1-4H;3H,2H2,1H3 |
| InChIKey | SFLCQWKJNDXPQS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
The IUPAC name of ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene (CID 21291280) is ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene.
What is the SMILES notation for ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
The canonical SMILES for ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene is CCO.c1cc2ccc1o2.
What is the InChIKey of ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
The InChIKey is SFLCQWKJNDXPQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O.C2H6O/c1-2-6-4-3-5(1)7-6;1-2-3/h1-4H;3H,2H2,1H3.
What are the key properties of ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene has a molecular weight of 138.17 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene is sourced from PubChem (CID 21291280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).