C30H22N4O6 — CID 21291301
4,7-bis(2-acetamidophenyl)-1,10-phenanthroline-2,9-dicarboxylic acid (PubChem CID 21291301) has the molecular formula C30H22N4O6 and a molecular weight of 534.53 g/mol. Its IUPAC name is 4,7-bis(2-acetamidophenyl)-1,10-phenanthroline-2,9-dicarboxylic acid.
| Compound Name | 4,7-bis(2-acetamidophenyl)-1,10-phenanthroline-2,9-dicarboxylic acid |
|---|---|
| PubChem CID | 21291301 |
| Molecular Formula | C30H22N4O6 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 4,7-bis(2-acetamidophenyl)-1,10-phenanthroline-2,9-dicarboxylic acid |
| SMILES | CC(=O)Nc1ccccc1-c1cc(C(=O)O)nc2c1ccc1c(-c3ccccc3NC(C)=O)cc(C(=O)O)nc12 |
| InChI | InChI=1S/C30H22N4O6/c1-15(35)31-23-9-5-3-7-17(23)21-13-25(29(37)38)33-27-19(21)11-12-20-22(14-26(30(39)40)34-28(20)27)18-8-4-6-10-24(18)32-16(2)36/h3-14H,1-2H3,(H,31,35)(H,32,36)(H,37,38)(H,39,40) |
| InChIKey | ILAKJKQIWQNRLZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 158.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|