C13H25N — CID 21292142
2,2,4,6,6-pentamethyl-1-prop-2-enylpiperidine (PubChem CID 21292142) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 2,2,4,6,6-pentamethyl-1-prop-2-enylpiperidine.
| Compound Name | 2,2,4,6,6-pentamethyl-1-prop-2-enylpiperidine |
|---|---|
| PubChem CID | 21292142 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2,2,4,6,6-pentamethyl-1-prop-2-enylpiperidine |
| SMILES | C=CCN1C(C)(C)CC(C)CC1(C)C |
| InChI | InChI=1S/C13H25N/c1-7-8-14-12(3,4)9-11(2)10-13(14,5)6/h7,11H,1,8-10H2,2-6H3 |
| InChIKey | OPLSJFIGDKLDSL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|