C17H31NO2 — CID 21292212
(E)-but-2-enoic acid;2,2,4,6,6-pentamethyl-1-prop-2-enylpiperidine (PubChem CID 21292212) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (E)-but-2-enoic acid;2,2,4,6,6-pentamethyl-1-prop-2-enylpiperidine.
| Compound Name | (E)-but-2-enoic acid;2,2,4,6,6-pentamethyl-1-prop-2-enylpiperidine |
|---|---|
| PubChem CID | 21292212 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (E)-but-2-enoic acid;2,2,4,6,6-pentamethyl-1-prop-2-enylpiperidine |
| SMILES | C/C=C/C(=O)O.C=CCN1C(C)(C)CC(C)CC1(C)C |
| InChI | InChI=1S/C13H25N.C4H6O2/c1-7-8-14-12(3,4)9-11(2)10-13(14,5)6;1-2-3-4(5)6/h7,11H,1,8-10H2,2-6H3;2-3H,1H3,(H,5,6)/b;3-2+ |
| InChIKey | YGURSCHYHKBEKV-ZPYUXNTASA-N |
| XLogP | 4.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|