About 1H-thieno[3,4-d]imidazole-2,4-dione
1H-thieno[3,4-d]imidazole-2,4-dione (PubChem CID 21292269) has the molecular formula C5H2N2O2S
and a molecular weight of 154.15 g/mol. Its IUPAC name is 1H-thieno[3,4-d]imidazole-2,4-dione.
Molecular Properties
| Compound Name | 1H-thieno[3,4-d]imidazole-2,4-dione |
| PubChem CID | 21292269 |
| Molecular Formula | C5H2N2O2S |
| Molecular Weight | 154.15 g/mol |
| Exact Mass | 153.98 |
| IUPAC Name | 1H-thieno[3,4-d]imidazole-2,4-dione |
| SMILES | O=C1N=C2C(=O)SC=C2N1 |
| InChI | InChI=1S/C5H2N2O2S/c8-4-3-2(1-10-4)6-5(9)7-3/h1H,(H,6,9) |
| InChIKey | FSFPGBWCDNRSIY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.15 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1H-thieno[3,4-d]imidazole-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-thieno[3,4-d]imidazole-2,4-dione?
The IUPAC name of 1H-thieno[3,4-d]imidazole-2,4-dione (CID 21292269) is 1H-thieno[3,4-d]imidazole-2,4-dione.
What is the SMILES notation for 1H-thieno[3,4-d]imidazole-2,4-dione?
The canonical SMILES for 1H-thieno[3,4-d]imidazole-2,4-dione is O=C1N=C2C(=O)SC=C2N1.
What is the InChIKey of 1H-thieno[3,4-d]imidazole-2,4-dione?
The InChIKey is FSFPGBWCDNRSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2N2O2S/c8-4-3-2(1-10-4)6-5(9)7-3/h1H,(H,6,9).
What are the key properties of 1H-thieno[3,4-d]imidazole-2,4-dione?
1H-thieno[3,4-d]imidazole-2,4-dione has a molecular weight of 154.15 g/mol, XLogP of 0.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-thieno[3,4-d]imidazole-2,4-dione is sourced from PubChem (CID 21292269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).