C21H35N — CID 21292499
8-tetradecyl-7-azabicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 21292499) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is 8-tetradecyl-7-azabicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 8-tetradecyl-7-azabicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 21292499 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | 8-tetradecyl-7-azabicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | CCCCCCCCCCCCCCC1Nc2ccccc21 |
| InChI | InChI=1S/C21H35N/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-20-19-16-14-15-18-21(19)22-20/h14-16,18,20,22H,2-13,17H2,1H3 |
| InChIKey | HBNJJEGKPDOKGV-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|