About acetic acid;phenylmethanamine
acetic acid;phenylmethanamine (PubChem CID 21292727) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is acetic acid;phenylmethanamine.
Molecular Properties
| Compound Name | acetic acid;phenylmethanamine |
| PubChem CID | 21292727 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | acetic acid;phenylmethanamine |
| SMILES | CC(=O)O.CC(=O)O.NCc1ccccc1 |
| InChI | InChI=1S/C7H9N.2C2H4O2/c8-6-7-4-2-1-3-5-7;2*1-2(3)4/h1-5H,6,8H2;2*1H3,(H,3,4) |
| InChIKey | BPBUSWYUSLTHBS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;phenylmethanamine?
The IUPAC name of acetic acid;phenylmethanamine (CID 21292727) is acetic acid;phenylmethanamine.
What is the SMILES notation for acetic acid;phenylmethanamine?
The canonical SMILES for acetic acid;phenylmethanamine is CC(=O)O.CC(=O)O.NCc1ccccc1.
What is the InChIKey of acetic acid;phenylmethanamine?
The InChIKey is BPBUSWYUSLTHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.2C2H4O2/c8-6-7-4-2-1-3-5-7;2*1-2(3)4/h1-5H,6,8H2;2*1H3,(H,3,4).
What are the key properties of acetic acid;phenylmethanamine?
acetic acid;phenylmethanamine has a molecular weight of 227.26 g/mol, XLogP of 1.33, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;phenylmethanamine is sourced from PubChem (CID 21292727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).