About 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride
4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride (PubChem CID 21293007) has the molecular formula C6H10ClN3O2S
and a molecular weight of 223.68 g/mol. Its IUPAC name is 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride.
Molecular Properties
| Compound Name | 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride |
| PubChem CID | 21293007 |
| Molecular Formula | C6H10ClN3O2S |
| Molecular Weight | 223.68 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride |
| SMILES | Cl.[H]/N=C(\CS)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C6H9N3O2S.ClH/c7-4(3-12)9-1-5(10)8-6(11)2-9;/h7,12H,1-3H2,(H,8,10,11);1H/b7-4+; |
| InChIKey | AQYYVTBLPVDEBX-KQGICBIGSA-N |
| XLogP | -0.73 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.68 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride?
The IUPAC name of 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride (CID 21293007) is 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride.
What is the SMILES notation for 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride?
The canonical SMILES for 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride is Cl.[H]/N=C(\CS)N1CC(=O)NC(=O)C1.
What is the InChIKey of 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride?
The InChIKey is AQYYVTBLPVDEBX-KQGICBIGSA-N. The full InChI is InChI=1S/C6H9N3O2S.ClH/c7-4(3-12)9-1-5(10)8-6(11)2-9;/h7,12H,1-3H2,(H,8,10,11);1H/b7-4+;.
What are the key properties of 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride?
4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride has a molecular weight of 223.68 g/mol, XLogP of -0.73, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-sulfanylethanimidoyl)piperazine-2,6-dione;hydrochloride is sourced from PubChem (CID 21293007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).