C15H21NO4 — CID 21293118
methyl 3-(N-acetyl-2,6-dimethylanilino)oxy-2-methylpropanoate (PubChem CID 21293118) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl 3-(N-acetyl-2,6-dimethylanilino)oxy-2-methylpropanoate.
| Compound Name | methyl 3-(N-acetyl-2,6-dimethylanilino)oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 21293118 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | methyl 3-(N-acetyl-2,6-dimethylanilino)oxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)CON(C(C)=O)c1c(C)cccc1C |
| InChI | InChI=1S/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(4)17)20-9-12(3)15(18)19-5/h6-8,12H,9H2,1-5H3 |
| InChIKey | XWEGBAFVGDWACN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|