1,2-dihydropyrimidine-2-carboxylic acid

C5H6N2O2 — CID 21293370

IUPAC1,2-dihydropyrimidine-2-carboxylic acid
SMILESO=C(O)C1N=CC=CN1
InChIInChI=1S/C5H6N2O2/c8-5(9)4-6-2-1-3-7-4/h1-4,6H,(H,8,9)
InChIKeyHYSXHMVQKWFHSD-UHFFFAOYSA-N
MW126.11 g/mol
LogP-0.42
Rot. Bonds1

About 1,2-dihydropyrimidine-2-carboxylic acid

1,2-dihydropyrimidine-2-carboxylic acid (PubChem CID 21293370) has the molecular formula C5H6N2O2 and a molecular weight of 126.11 g/mol. Its IUPAC name is 1,2-dihydropyrimidine-2-carboxylic acid.

Molecular Properties

Compound Name1,2-dihydropyrimidine-2-carboxylic acid
PubChem CID21293370
Molecular FormulaC5H6N2O2
Molecular Weight126.11 g/mol
Exact Mass126.04
IUPAC Name1,2-dihydropyrimidine-2-carboxylic acid
SMILESO=C(O)C1N=CC=CN1
InChIInChI=1S/C5H6N2O2/c8-5(9)4-6-2-1-3-7-4/h1-4,6H,(H,8,9)
InChIKeyHYSXHMVQKWFHSD-UHFFFAOYSA-N
XLogP-0.42
TPSA61.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500126.11
LogP ≤ 5-0.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1,2-dihydropyrimidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-dihydropyrimidine-2-carboxylic acid?
The IUPAC name of 1,2-dihydropyrimidine-2-carboxylic acid (CID 21293370) is 1,2-dihydropyrimidine-2-carboxylic acid.
What is the SMILES notation for 1,2-dihydropyrimidine-2-carboxylic acid?
The canonical SMILES for 1,2-dihydropyrimidine-2-carboxylic acid is O=C(O)C1N=CC=CN1.
What is the InChIKey of 1,2-dihydropyrimidine-2-carboxylic acid?
The InChIKey is HYSXHMVQKWFHSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2/c8-5(9)4-6-2-1-3-7-4/h1-4,6H,(H,8,9).
What are the key properties of 1,2-dihydropyrimidine-2-carboxylic acid?
1,2-dihydropyrimidine-2-carboxylic acid has a molecular weight of 126.11 g/mol, XLogP of -0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydropyrimidine-2-carboxylic acid is sourced from PubChem (CID 21293370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).