C10H15F7O2 — CID 21293389
6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-diol (PubChem CID 21293389) has the molecular formula C10H15F7O2 and a molecular weight of 300.21 g/mol. Its IUPAC name is 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-diol.
| Compound Name | 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-diol |
|---|---|
| PubChem CID | 21293389 |
| Molecular Formula | C10H15F7O2 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-diol |
| SMILES | CC(C)(C)C(O)CC(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H15F7O2/c1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17/h5-6,18-19H,4H2,1-3H3 |
| InChIKey | CEUYTDVKBAPCPW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|