C18H33N5O2 — CID 21293829
N-butyl-4,6-dimethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine (PubChem CID 21293829) has the molecular formula C18H33N5O2 and a molecular weight of 351.50 g/mol. Its IUPAC name is N-butyl-4,6-dimethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-butyl-4,6-dimethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 21293829 |
| Molecular Formula | C18H33N5O2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | N-butyl-4,6-dimethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
| SMILES | CCCCN(c1nc(OC)nc(OC)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C18H33N5O2/c1-8-9-10-23(13-11-17(2,3)22-18(4,5)12-13)14-19-15(24-6)21-16(20-14)25-7/h13,22H,8-12H2,1-7H3 |
| InChIKey | PNFMRKGIKCIBET-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |