C18H27NO — CID 21294843
1-[(4-ethenylphenyl)methoxy]-2,2,6,6-tetramethylpiperidine (PubChem CID 21294843) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-[(4-ethenylphenyl)methoxy]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-[(4-ethenylphenyl)methoxy]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 21294843 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 1-[(4-ethenylphenyl)methoxy]-2,2,6,6-tetramethylpiperidine |
| SMILES | C=Cc1ccc(CON2C(C)(C)CCCC2(C)C)cc1 |
| InChI | InChI=1S/C18H27NO/c1-6-15-8-10-16(11-9-15)14-20-19-17(2,3)12-7-13-18(19,4)5/h6,8-11H,1,7,12-14H2,2-5H3 |
| InChIKey | FWSDJRSDDFHTTQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |