About 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide
2-amino-2-cyclohexa-1,5-dien-1-ylacetamide (PubChem CID 21294885) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide.
Molecular Properties
| Compound Name | 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide |
| PubChem CID | 21294885 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide |
| SMILES | NC(=O)C(N)C1=CCCC=C1 |
| InChI | InChI=1S/C8H12N2O/c9-7(8(10)11)6-4-2-1-3-5-6/h2,4-5,7H,1,3,9H2,(H2,10,11) |
| InChIKey | ROGOEHDDQVDJSJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide?
The IUPAC name of 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide (CID 21294885) is 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide.
What is the SMILES notation for 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide?
The canonical SMILES for 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide is NC(=O)C(N)C1=CCCC=C1.
What is the InChIKey of 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide?
The InChIKey is ROGOEHDDQVDJSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c9-7(8(10)11)6-4-2-1-3-5-6/h2,4-5,7H,1,3,9H2,(H2,10,11).
What are the key properties of 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide?
2-amino-2-cyclohexa-1,5-dien-1-ylacetamide has a molecular weight of 152.20 g/mol, XLogP of 0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-cyclohexa-1,5-dien-1-ylacetamide is sourced from PubChem (CID 21294885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).