C8H16N2O — CID 21295645
3,3-dimethyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazine (PubChem CID 21295645) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 3,3-dimethyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazine.
| Compound Name | 3,3-dimethyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazine |
|---|---|
| PubChem CID | 21295645 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 3,3-dimethyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazine |
| SMILES | CC1(C)OCC2CNCCN21 |
| InChI | InChI=1S/C8H16N2O/c1-8(2)10-4-3-9-5-7(10)6-11-8/h7,9H,3-6H2,1-2H3 |
| InChIKey | DOZMYMGJEIXXKZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |