C23H29F2N3O — CID 21295711
1-[4,4-bis(4-fluorophenyl)butyl]-N,N-dimethylpiperazine-2-carboxamide (PubChem CID 21295711) has the molecular formula C23H29F2N3O and a molecular weight of 401.50 g/mol. Its IUPAC name is 1-[4,4-bis(4-fluorophenyl)butyl]-N,N-dimethylpiperazine-2-carboxamide.
| Compound Name | 1-[4,4-bis(4-fluorophenyl)butyl]-N,N-dimethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 21295711 |
| Molecular Formula | C23H29F2N3O |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 1-[4,4-bis(4-fluorophenyl)butyl]-N,N-dimethylpiperazine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CNCCN1CCCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H29F2N3O/c1-27(2)23(29)22-16-26-13-15-28(22)14-3-4-21(17-5-9-19(24)10-6-17)18-7-11-20(25)12-8-18/h5-12,21-22,26H,3-4,13-16H2,1-2H3 |
| InChIKey | AOLZKLKQSZDIFE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |