About ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate
ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate (PubChem CID 21295837) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate |
| PubChem CID | 21295837 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate |
| SMILES | CCOC(=O)N1C=CC(C(C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C14H23NO2/c1-7-17-13(16)15-9-8-12(14(4,5)6)10(2)11(15)3/h8-9,12H,7H2,1-6H3 |
| InChIKey | XFZVXOBETXPUBN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate?
The IUPAC name of ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate (CID 21295837) is ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate.
What is the SMILES notation for ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate?
The canonical SMILES for ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate is CCOC(=O)N1C=CC(C(C)(C)C)C(C)=C1C.
What is the InChIKey of ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate?
The InChIKey is XFZVXOBETXPUBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO2/c1-7-17-13(16)15-9-8-12(14(4,5)6)10(2)11(15)3/h8-9,12H,7H2,1-6H3.
What are the key properties of ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate?
ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate has a molecular weight of 237.34 g/mol, XLogP of 3.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-tert-butyl-2,3-dimethyl-4H-pyridine-1-carboxylate is sourced from PubChem (CID 21295837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).