C29H32N3O2S2+ — CID 21295996
2-[2-[(benzyldisulfanyl)methyl]-4-methoxy-3-methylpyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one (PubChem CID 21295996) has the molecular formula C29H32N3O2S2+ and a molecular weight of 518.73 g/mol. Its IUPAC name is 2-[2-[(benzyldisulfanyl)methyl]-4-methoxy-3-methylpyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one.
| Compound Name | 2-[2-[(benzyldisulfanyl)methyl]-4-methoxy-3-methylpyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one |
|---|---|
| PubChem CID | 21295996 |
| Molecular Formula | C29H32N3O2S2+ |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 2-[2-[(benzyldisulfanyl)methyl]-4-methoxy-3-methylpyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one |
| SMILES | COc1cc[n+](-c2nc3cc4c(cc3[nH]2)C(C)(C)C(=O)C4(C)C)c(CSSCc2ccccc2)c1C |
| InChI | InChI=1S/C29H32N3O2S2/c1-18-24(17-36-35-16-19-10-8-7-9-11-19)32(13-12-25(18)34-6)27-30-22-14-20-21(15-23(22)31-27)29(4,5)26(33)28(20,2)3/h7-15H,16-17H2,1-6H3,(H,30,31)/q+1 |
| InChIKey | YLALBXHSKOWMKE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|