C20H24N3O3S2+ — CID 21296057
6-[4-methoxy-3,5-dimethyl-2-[(propyldisulfanyl)methyl]pyridin-1-ium-1-yl]-5H-[1,3]dioxolo[4,5-f]benzimidazole (PubChem CID 21296057) has the molecular formula C20H24N3O3S2+ and a molecular weight of 418.56 g/mol. Its IUPAC name is 6-[4-methoxy-3,5-dimethyl-2-[(propyldisulfanyl)methyl]pyridin-1-ium-1-yl]-5H-[1,3]dioxolo[4,5-f]benzimidazole.
| Compound Name | 6-[4-methoxy-3,5-dimethyl-2-[(propyldisulfanyl)methyl]pyridin-1-ium-1-yl]-5H-[1,3]dioxolo[4,5-f]benzimidazole |
|---|---|
| PubChem CID | 21296057 |
| Molecular Formula | C20H24N3O3S2+ |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 6-[4-methoxy-3,5-dimethyl-2-[(propyldisulfanyl)methyl]pyridin-1-ium-1-yl]-5H-[1,3]dioxolo[4,5-f]benzimidazole |
| SMILES | CCCSSCc1c(C)c(OC)c(C)c[n+]1-c1nc2cc3c(cc2[nH]1)OCO3 |
| InChI | InChI=1S/C20H24N3O3S2/c1-5-6-27-28-10-16-13(3)19(24-4)12(2)9-23(16)20-21-14-7-17-18(26-11-25-17)8-15(14)22-20/h7-9H,5-6,10-11H2,1-4H3,(H,21,22)/q+1 |
| InChIKey | MIAHAWZYOSVDEI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 60.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|