About [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid
[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid (PubChem CID 21296217) has the molecular formula C12H13FN2O4
and a molecular weight of 268.24 g/mol. Its IUPAC name is [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid.
Molecular Properties
| Compound Name | [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid |
| PubChem CID | 21296217 |
| Molecular Formula | C12H13FN2O4 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid |
| SMILES | CC1(C)Cc2cccc(N(NC(=O)O)C(=O)F)c2O1 |
| InChI | InChI=1S/C12H13FN2O4/c1-12(2)6-7-4-3-5-8(9(7)19-12)15(10(13)16)14-11(17)18/h3-5,14H,6H2,1-2H3,(H,17,18) |
| InChIKey | VIANFWIEUHPIJF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid?
The IUPAC name of [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid (CID 21296217) is [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid.
What is the SMILES notation for [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid?
The canonical SMILES for [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid is CC1(C)Cc2cccc(N(NC(=O)O)C(=O)F)c2O1.
What is the InChIKey of [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid?
The InChIKey is VIANFWIEUHPIJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O4/c1-12(2)6-7-4-3-5-8(9(7)19-12)15(10(13)16)14-11(17)18/h3-5,14H,6H2,1-2H3,(H,17,18).
What are the key properties of [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid?
[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid has a molecular weight of 268.24 g/mol, XLogP of 2.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamic acid is sourced from PubChem (CID 21296217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).