C28H27N3O6S — CID 21296562
diethyl 2,6-dimethyl-4-[2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 21296562) has the molecular formula C28H27N3O6S and a molecular weight of 533.61 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-4-[2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-dimethyl-4-[2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 21296562 |
| Molecular Formula | C28H27N3O6S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | diethyl 2,6-dimethyl-4-[2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccccc1-c1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C28H27N3O6S/c1-5-36-27(32)23-16(3)29-17(4)24(28(33)37-6-2)25(23)20-9-7-8-10-21(20)26-30-22(15-38-26)18-11-13-19(14-12-18)31(34)35/h7-15,25,29H,5-6H2,1-4H3 |
| InChIKey | LILYLLSHFAAFNL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|