C28H22O4 — CID 21297031
1,4,4a,9a-tetrahydroanthracene-9,10-dione;1,4-dihydroanthracene-9,10-dione (PubChem CID 21297031) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is 1,4,4a,9a-tetrahydroanthracene-9,10-dione;1,4-dihydroanthracene-9,10-dione.
| Compound Name | 1,4,4a,9a-tetrahydroanthracene-9,10-dione;1,4-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 21297031 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 1,4,4a,9a-tetrahydroanthracene-9,10-dione;1,4-dihydroanthracene-9,10-dione |
| SMILES | O=C1C2=C(CC=CC2)C(=O)c2ccccc21.O=C1c2ccccc2C(=O)C2CC=CCC12 |
| InChI | InChI=1S/C14H12O2.C14H10O2/c2*15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-6,11-12H,7-8H2;1-6H,7-8H2 |
| InChIKey | XTFKDPZEFUOUKN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|