About 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione
1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione (PubChem CID 21297092) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione |
| PubChem CID | 21297092 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1CN(CC2CO2)C(=O)N1CC1CO1 |
| InChI | InChI=1S/C9H12N2O4/c12-8-3-10(1-6-4-14-6)9(13)11(8)2-7-5-15-7/h6-7H,1-5H2 |
| InChIKey | CGACJVBTDXJSDR-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 65.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione?
The IUPAC name of 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione (CID 21297092) is 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione.
What is the SMILES notation for 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione?
The canonical SMILES for 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione is O=C1CN(CC2CO2)C(=O)N1CC1CO1.
What is the InChIKey of 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione?
The InChIKey is CGACJVBTDXJSDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c12-8-3-10(1-6-4-14-6)9(13)11(8)2-7-5-15-7/h6-7H,1-5H2.
What are the key properties of 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione?
1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione has a molecular weight of 212.20 g/mol, XLogP of -0.95, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione is sourced from PubChem (CID 21297092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).