About 1-methyl-3,4-dihydroquinoxalin-2-one
1-methyl-3,4-dihydroquinoxalin-2-one (PubChem CID 21297195) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-methyl-3,4-dihydroquinoxalin-2-one.
Molecular Properties
| Compound Name | 1-methyl-3,4-dihydroquinoxalin-2-one |
| PubChem CID | 21297195 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1-methyl-3,4-dihydroquinoxalin-2-one |
| SMILES | CN1C(=O)CNc2ccccc21 |
| InChI | InChI=1S/C9H10N2O/c1-11-8-5-3-2-4-7(8)10-6-9(11)12/h2-5,10H,6H2,1H3 |
| InChIKey | JFWAVAHCZRTHLM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-3,4-dihydroquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,4-dihydroquinoxalin-2-one?
The IUPAC name of 1-methyl-3,4-dihydroquinoxalin-2-one (CID 21297195) is 1-methyl-3,4-dihydroquinoxalin-2-one.
What is the SMILES notation for 1-methyl-3,4-dihydroquinoxalin-2-one?
The canonical SMILES for 1-methyl-3,4-dihydroquinoxalin-2-one is CN1C(=O)CNc2ccccc21.
What is the InChIKey of 1-methyl-3,4-dihydroquinoxalin-2-one?
The InChIKey is JFWAVAHCZRTHLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-11-8-5-3-2-4-7(8)10-6-9(11)12/h2-5,10H,6H2,1H3.
What are the key properties of 1-methyl-3,4-dihydroquinoxalin-2-one?
1-methyl-3,4-dihydroquinoxalin-2-one has a molecular weight of 162.19 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,4-dihydroquinoxalin-2-one is sourced from PubChem (CID 21297195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).