C10H12N2O — CID 21297204
3-methyl-4,5-dihydro-1H-1,3-benzodiazepin-2-one (PubChem CID 21297204) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-methyl-4,5-dihydro-1H-1,3-benzodiazepin-2-one.
| Compound Name | 3-methyl-4,5-dihydro-1H-1,3-benzodiazepin-2-one |
|---|---|
| PubChem CID | 21297204 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-methyl-4,5-dihydro-1H-1,3-benzodiazepin-2-one |
| SMILES | CN1CCc2ccccc2NC1=O |
| InChI | InChI=1S/C10H12N2O/c1-12-7-6-8-4-2-3-5-9(8)11-10(12)13/h2-5H,6-7H2,1H3,(H,11,13) |
| InChIKey | CHZRTXKKKOYGJO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |