About 3-ethyloxiran-2-one
3-ethyloxiran-2-one (PubChem CID 21297762) has the molecular formula C4H6O2
and a molecular weight of 86.09 g/mol. Its IUPAC name is 3-ethyloxiran-2-one.
Molecular Properties
| Compound Name | 3-ethyloxiran-2-one |
| PubChem CID | 21297762 |
| Molecular Formula | C4H6O2 |
| Molecular Weight | 86.09 g/mol |
| Exact Mass | 86.04 |
| IUPAC Name | 3-ethyloxiran-2-one |
| SMILES | CCC1OC1=O |
| InChI | InChI=1S/C4H6O2/c1-2-3-4(5)6-3/h3H,2H2,1H3 |
| InChIKey | ZOMPBXWFMAJRRU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.09 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyloxiran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyloxiran-2-one?
The IUPAC name of 3-ethyloxiran-2-one (CID 21297762) is 3-ethyloxiran-2-one.
What is the SMILES notation for 3-ethyloxiran-2-one?
The canonical SMILES for 3-ethyloxiran-2-one is CCC1OC1=O.
What is the InChIKey of 3-ethyloxiran-2-one?
The InChIKey is ZOMPBXWFMAJRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2/c1-2-3-4(5)6-3/h3H,2H2,1H3.
What are the key properties of 3-ethyloxiran-2-one?
3-ethyloxiran-2-one has a molecular weight of 86.09 g/mol, XLogP of 0.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyloxiran-2-one is sourced from PubChem (CID 21297762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).