C25H49NO2 — CID 21297912
1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadecan-1-one (PubChem CID 21297912) has the molecular formula C25H49NO2 and a molecular weight of 395.67 g/mol. Its IUPAC name is 1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadecan-1-one.
| Compound Name | 1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadecan-1-one |
|---|---|
| PubChem CID | 21297912 |
| Molecular Formula | C25H49NO2 |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 395.38 |
| IUPAC Name | 1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadecan-1-one |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C25H49NO2/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)18-25(28)26-17-9-16-24(27)19-26/h20-24,27H,6-19H2,1-5H3 |
| InChIKey | FBUSEUYLTFNKRV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |