C27H46N2O — CID 21297915
(2E,6E,10E,14E)-N-(2-aminoethyl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide (PubChem CID 21297915) has the molecular formula C27H46N2O and a molecular weight of 414.68 g/mol. Its IUPAC name is (2E,6E,10E,14E)-N-(2-aminoethyl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide.
| Compound Name | (2E,6E,10E,14E)-N-(2-aminoethyl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide |
|---|---|
| PubChem CID | 21297915 |
| Molecular Formula | C27H46N2O |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.36 |
| IUPAC Name | (2E,6E,10E,14E)-N-(2-aminoethyl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)NCCN |
| InChI | InChI=1S/C27H46N2O/c1-22(2)11-7-12-23(3)13-8-14-24(4)15-9-16-25(5)17-10-18-26(6)21-27(30)29-20-19-28/h11,13,15,17,21H,7-10,12,14,16,18-20,28H2,1-6H3,(H,29,30)/b23-13+,24-15+,25-17+,26-21+ |
| InChIKey | OPVLJPXPMYNIES-ZBPGHHTISA-N |
| XLogP | 6.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|