C17H29NO2 — CID 21297933
(2E,6E)-N-(2-hydroxyethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide (PubChem CID 21297933) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is (2E,6E)-N-(2-hydroxyethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide.
| Compound Name | (2E,6E)-N-(2-hydroxyethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 21297933 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | (2E,6E)-N-(2-hydroxyethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(=O)NCCO |
| InChI | InChI=1S/C17H29NO2/c1-14(2)7-5-8-15(3)9-6-10-16(4)13-17(20)18-11-12-19/h7,9,13,19H,5-6,8,10-12H2,1-4H3,(H,18,20)/b15-9+,16-13+ |
| InChIKey | XIPTWGWYBDLXGA-RNPYNJAESA-N |
| XLogP | 3.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|