C17H30N2O — CID 21297956
(2E,6E)-N-(2-aminoethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide (PubChem CID 21297956) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is (2E,6E)-N-(2-aminoethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide.
| Compound Name | (2E,6E)-N-(2-aminoethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 21297956 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | (2E,6E)-N-(2-aminoethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(=O)NCCN |
| InChI | InChI=1S/C17H30N2O/c1-14(2)7-5-8-15(3)9-6-10-16(4)13-17(20)19-12-11-18/h7,9,13H,5-6,8,10-12,18H2,1-4H3,(H,19,20)/b15-9+,16-13+ |
| InChIKey | QKZWYIIZWKIJHC-RNPYNJAESA-N |
| XLogP | 3.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|