C25H41NO3 — CID 21297957
propyl 2-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]acetate (PubChem CID 21297957) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is propyl 2-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]acetate.
| Compound Name | propyl 2-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]acetate |
|---|---|
| PubChem CID | 21297957 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | propyl 2-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]acetate |
| SMILES | CCCOC(=O)CNC(=O)/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H41NO3/c1-7-17-29-25(28)19-26-24(27)18-23(6)16-10-15-22(5)14-9-13-21(4)12-8-11-20(2)3/h11,13,15,18H,7-10,12,14,16-17,19H2,1-6H3,(H,26,27)/b21-13+,22-15+,23-18+ |
| InChIKey | MPHDUFZASCCAAF-UZENZRIMSA-N |
| XLogP | 6.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|