C26H48N2 — CID 21297959
N',N'-diethyl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]ethane-1,2-diamine (PubChem CID 21297959) has the molecular formula C26H48N2 and a molecular weight of 388.68 g/mol. Its IUPAC name is N',N'-diethyl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 21297959 |
| Molecular Formula | C26H48N2 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.38 |
| IUPAC Name | N',N'-diethyl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H48N2/c1-8-28(9-2)22-21-27-20-19-26(7)18-12-17-25(6)16-11-15-24(5)14-10-13-23(3)4/h13,15,17,19,27H,8-12,14,16,18,20-22H2,1-7H3/b24-15+,25-17+,26-19+ |
| InChIKey | BWJUFHRPKOYHES-QGBZOTKOSA-N |
| XLogP | 7.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|