C22H43NO2 — CID 21297963
(E)-N-(2-hydroxyethyl)-3,7,11,15-tetramethylhexadec-2-enamide (PubChem CID 21297963) has the molecular formula C22H43NO2 and a molecular weight of 353.59 g/mol. Its IUPAC name is (E)-N-(2-hydroxyethyl)-3,7,11,15-tetramethylhexadec-2-enamide.
| Compound Name | (E)-N-(2-hydroxyethyl)-3,7,11,15-tetramethylhexadec-2-enamide |
|---|---|
| PubChem CID | 21297963 |
| Molecular Formula | C22H43NO2 |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.33 |
| IUPAC Name | (E)-N-(2-hydroxyethyl)-3,7,11,15-tetramethylhexadec-2-enamide |
| SMILES | C/C(=C\C(=O)NCCO)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C22H43NO2/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)17-22(25)23-15-16-24/h17-20,24H,6-16H2,1-5H3,(H,23,25)/b21-17+ |
| InChIKey | OKUKILRUTZSUAH-HEHNFIMWSA-N |
| XLogP | 5.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|