C25H43NO2 — CID 21297967
(6E,10E)-1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trien-1-one (PubChem CID 21297967) has the molecular formula C25H43NO2 and a molecular weight of 389.62 g/mol. Its IUPAC name is (6E,10E)-1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trien-1-one.
| Compound Name | (6E,10E)-1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trien-1-one |
|---|---|
| PubChem CID | 21297967 |
| Molecular Formula | C25H43NO2 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.33 |
| IUPAC Name | (6E,10E)-1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trien-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(C)CC(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C25H43NO2/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)18-25(28)26-17-9-16-24(27)19-26/h10,12,14,23-24,27H,6-9,11,13,15-19H2,1-5H3/b21-12+,22-14+ |
| InChIKey | PXHUPSXTVGZIFI-QRCIITMISA-N |
| XLogP | 6.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|