C22H37NO2 — CID 21297982
(2E,6E,10E)-N-(2-hydroxyethyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide (PubChem CID 21297982) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is (2E,6E,10E)-N-(2-hydroxyethyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide.
| Compound Name | (2E,6E,10E)-N-(2-hydroxyethyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide |
|---|---|
| PubChem CID | 21297982 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | (2E,6E,10E)-N-(2-hydroxyethyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)NCCO |
| InChI | InChI=1S/C22H37NO2/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)17-22(25)23-15-16-24/h9,11,13,17,24H,6-8,10,12,14-16H2,1-5H3,(H,23,25)/b19-11+,20-13+,21-17+ |
| InChIKey | QYISNUCXMFHVMX-FPSROUMGSA-N |
| XLogP | 5.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|