C22H38N2O — CID 21297990
(2E,6E)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3,7,11-trimethyldodeca-2,6,10-trienamide (PubChem CID 21297990) has the molecular formula C22H38N2O and a molecular weight of 346.56 g/mol. Its IUPAC name is (2E,6E)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3,7,11-trimethyldodeca-2,6,10-trienamide.
| Compound Name | (2E,6E)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3,7,11-trimethyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 21297990 |
| Molecular Formula | C22H38N2O |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | (2E,6E)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3,7,11-trimethyldodeca-2,6,10-trienamide |
| SMILES | CCN1CCCC1CNC(=O)/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H38N2O/c1-6-24-15-9-14-21(24)17-23-22(25)16-20(5)13-8-12-19(4)11-7-10-18(2)3/h10,12,16,21H,6-9,11,13-15,17H2,1-5H3,(H,23,25)/b19-12+,20-16+ |
| InChIKey | LHWBPEYPDPGOJS-YEFHWUCQSA-N |
| XLogP | 5.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|