C27H48N2O — CID 21298051
(6E,10E)-N-(1-ethylpiperidin-3-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide (PubChem CID 21298051) has the molecular formula C27H48N2O and a molecular weight of 416.69 g/mol. Its IUPAC name is (6E,10E)-N-(1-ethylpiperidin-3-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide.
| Compound Name | (6E,10E)-N-(1-ethylpiperidin-3-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide |
|---|---|
| PubChem CID | 21298051 |
| Molecular Formula | C27H48N2O |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.38 |
| IUPAC Name | (6E,10E)-N-(1-ethylpiperidin-3-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide |
| SMILES | CCN1CCCC(NC(=O)CC(C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1 |
| InChI | InChI=1S/C27H48N2O/c1-7-29-19-11-18-26(21-29)28-27(30)20-25(6)17-10-16-24(5)15-9-14-23(4)13-8-12-22(2)3/h12,14,16,25-26H,7-11,13,15,17-21H2,1-6H3,(H,28,30)/b23-14+,24-16+ |
| InChIKey | UDXAHUGTMVZMBC-XYVQYNESSA-N |
| XLogP | 6.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|