C25H44N2O — CID 21298075
(6E,10E)-3,7,11,15-tetramethyl-1-(4-methylpiperazin-1-yl)hexadeca-6,10,14-trien-1-one (PubChem CID 21298075) has the molecular formula C25H44N2O and a molecular weight of 388.64 g/mol. Its IUPAC name is (6E,10E)-3,7,11,15-tetramethyl-1-(4-methylpiperazin-1-yl)hexadeca-6,10,14-trien-1-one.
| Compound Name | (6E,10E)-3,7,11,15-tetramethyl-1-(4-methylpiperazin-1-yl)hexadeca-6,10,14-trien-1-one |
|---|---|
| PubChem CID | 21298075 |
| Molecular Formula | C25H44N2O |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.35 |
| IUPAC Name | (6E,10E)-3,7,11,15-tetramethyl-1-(4-methylpiperazin-1-yl)hexadeca-6,10,14-trien-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(C)CC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C25H44N2O/c1-21(2)10-7-11-22(3)12-8-13-23(4)14-9-15-24(5)20-25(28)27-18-16-26(6)17-19-27/h10,12,14,24H,7-9,11,13,15-20H2,1-6H3/b22-12+,23-14+ |
| InChIKey | ADZKVVWWRUYRAL-DGYUODJOSA-N |
| XLogP | 5.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|