C13H21N3S — CID 21298213
6-propyl-5,5a,7,8,9,9a-hexahydro-4H-[1,3]thiazolo[4,5-f]quinolin-2-amine (PubChem CID 21298213) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 6-propyl-5,5a,7,8,9,9a-hexahydro-4H-[1,3]thiazolo[4,5-f]quinolin-2-amine.
| Compound Name | 6-propyl-5,5a,7,8,9,9a-hexahydro-4H-[1,3]thiazolo[4,5-f]quinolin-2-amine |
|---|---|
| PubChem CID | 21298213 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 6-propyl-5,5a,7,8,9,9a-hexahydro-4H-[1,3]thiazolo[4,5-f]quinolin-2-amine |
| SMILES | CCCN1CCCC2c3nc(N)sc3CCC21 |
| InChI | InChI=1S/C13H21N3S/c1-2-7-16-8-3-4-9-10(16)5-6-11-12(9)15-13(14)17-11/h9-10H,2-8H2,1H3,(H2,14,15) |
| InChIKey | YZXHGMLAVBMVDU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |