About 2-chloro-4,5-dimethylbenzoyl chloride
2-chloro-4,5-dimethylbenzoyl chloride (PubChem CID 21298243) has the molecular formula C9H8Cl2O
and a molecular weight of 203.07 g/mol. Its IUPAC name is 2-chloro-4,5-dimethylbenzoyl chloride.
Molecular Properties
| Compound Name | 2-chloro-4,5-dimethylbenzoyl chloride |
| PubChem CID | 21298243 |
| Molecular Formula | C9H8Cl2O |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | 2-chloro-4,5-dimethylbenzoyl chloride |
| SMILES | Cc1cc(Cl)c(C(=O)Cl)cc1C |
| InChI | InChI=1S/C9H8Cl2O/c1-5-3-7(9(11)12)8(10)4-6(5)2/h3-4H,1-2H3 |
| InChIKey | ZMHCAITXIXQUFJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4,5-dimethylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,5-dimethylbenzoyl chloride?
The IUPAC name of 2-chloro-4,5-dimethylbenzoyl chloride (CID 21298243) is 2-chloro-4,5-dimethylbenzoyl chloride.
What is the SMILES notation for 2-chloro-4,5-dimethylbenzoyl chloride?
The canonical SMILES for 2-chloro-4,5-dimethylbenzoyl chloride is Cc1cc(Cl)c(C(=O)Cl)cc1C.
What is the InChIKey of 2-chloro-4,5-dimethylbenzoyl chloride?
The InChIKey is ZMHCAITXIXQUFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2O/c1-5-3-7(9(11)12)8(10)4-6(5)2/h3-4H,1-2H3.
What are the key properties of 2-chloro-4,5-dimethylbenzoyl chloride?
2-chloro-4,5-dimethylbenzoyl chloride has a molecular weight of 203.07 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,5-dimethylbenzoyl chloride is sourced from PubChem (CID 21298243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).